C8H10F3N4O3+ — CID 6333667
dihydroxy(oxo)azanium;2-[3-(trifluoromethyl)phenyl]guanidine (PubChem CID 6333667) has the molecular formula C8H10F3N4O3+ and a molecular weight of 267.19 g/mol. Its IUPAC name is dihydroxy(oxo)azanium;2-[3-(trifluoromethyl)phenyl]guanidine.
| Compound Name | dihydroxy(oxo)azanium;2-[3-(trifluoromethyl)phenyl]guanidine |
|---|---|
| PubChem CID | 6333667 |
| Molecular Formula | C8H10F3N4O3+ |
| Molecular Weight | 267.19 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | dihydroxy(oxo)azanium;2-[3-(trifluoromethyl)phenyl]guanidine |
| SMILES | NC(N)=Nc1cccc(C(F)(F)F)c1.O=[N+](O)O |
| InChI | InChI=1S/C8H8F3N3.H2NO3/c9-8(10,11)5-2-1-3-6(4-5)14-7(12)13;2-1(3)4/h1-4H,(H4,12,13,14);(H2,2,3,4)/q;+1 |
| InChIKey | FSDOJJJZUVKQJC-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 124.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.19 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|