C13H13Cl2F3N4 — CID 70205107
2-[3-[3-(trifluoromethyl)-2-pyridinyl]phenyl]guanidine;dihydrochloride (PubChem CID 70205107) has the molecular formula C13H13Cl2F3N4 and a molecular weight of 353.18 g/mol. Its IUPAC name is 2-[3-[3-(trifluoromethyl)-2-pyridinyl]phenyl]guanidine;dihydrochloride.
| Compound Name | 2-[3-[3-(trifluoromethyl)-2-pyridinyl]phenyl]guanidine;dihydrochloride |
|---|---|
| PubChem CID | 70205107 |
| Molecular Formula | C13H13Cl2F3N4 |
| Molecular Weight | 353.18 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | 2-[3-[3-(trifluoromethyl)-2-pyridinyl]phenyl]guanidine;dihydrochloride |
| SMILES | Cl.Cl.NC(N)=Nc1cccc(-c2ncccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C13H11F3N4.2ClH/c14-13(15,16)10-5-2-6-19-11(10)8-3-1-4-9(7-8)20-12(17)18;;/h1-7H,(H4,17,18,20);2*1H |
| InChIKey | FPISMCYZCQWVJY-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.18 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|