C20H12F3N3O — CID 174467134
4-[7-[3-(trifluoromethyl)-2-pyridinyl]quinazolin-4-yl]phenol (PubChem CID 174467134) has the molecular formula C20H12F3N3O and a molecular weight of 367.33 g/mol. Its IUPAC name is 4-[7-[3-(trifluoromethyl)-2-pyridinyl]quinazolin-4-yl]phenol.
| Compound Name | 4-[7-[3-(trifluoromethyl)-2-pyridinyl]quinazolin-4-yl]phenol |
|---|---|
| PubChem CID | 174467134 |
| Molecular Formula | C20H12F3N3O |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 4-[7-[3-(trifluoromethyl)-2-pyridinyl]quinazolin-4-yl]phenol |
| SMILES | Oc1ccc(-c2ncnc3cc(-c4ncccc4C(F)(F)F)ccc23)cc1 |
| InChI | InChI=1S/C20H12F3N3O/c21-20(22,23)16-2-1-9-24-19(16)13-5-8-15-17(10-13)25-11-26-18(15)12-3-6-14(27)7-4-12/h1-11,27H |
| InChIKey | QBEAPNSPZWRLJN-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |