C21H12F6N4 — CID 46203537
7-[3-(trifluoromethyl)-2-pyridinyl]-N-[5-(trifluoromethyl)-2-pyridinyl]quinolin-4-amine (PubChem CID 46203537) has the molecular formula C21H12F6N4 and a molecular weight of 434.34 g/mol. Its IUPAC name is 7-[3-(trifluoromethyl)-2-pyridinyl]-N-[5-(trifluoromethyl)-2-pyridinyl]quinolin-4-amine.
| Compound Name | 7-[3-(trifluoromethyl)-2-pyridinyl]-N-[5-(trifluoromethyl)-2-pyridinyl]quinolin-4-amine |
|---|---|
| PubChem CID | 46203537 |
| Molecular Formula | C21H12F6N4 |
| Molecular Weight | 434.34 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | 7-[3-(trifluoromethyl)-2-pyridinyl]-N-[5-(trifluoromethyl)-2-pyridinyl]quinolin-4-amine |
| SMILES | FC(F)(F)c1ccc(Nc2ccnc3cc(-c4ncccc4C(F)(F)F)ccc23)nc1 |
| InChI | InChI=1S/C21H12F6N4/c22-20(23,24)13-4-6-18(30-11-13)31-16-7-9-28-17-10-12(3-5-14(16)17)19-15(21(25,26)27)2-1-8-29-19/h1-11H,(H,28,30,31) |
| InChIKey | ZZFNGMUTCXRSSB-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.34 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |