C20H13F3N4 — CID 11748887
N-(2-quinolin-7-yl-4-pyridinyl)-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 11748887) has the molecular formula C20H13F3N4 and a molecular weight of 366.35 g/mol. Its IUPAC name is N-(2-quinolin-7-yl-4-pyridinyl)-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-(2-quinolin-7-yl-4-pyridinyl)-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 11748887 |
| Molecular Formula | C20H13F3N4 |
| Molecular Weight | 366.35 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | N-(2-quinolin-7-yl-4-pyridinyl)-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | FC(F)(F)c1ccc(Nc2ccnc(-c3ccc4cccnc4c3)c2)nc1 |
| InChI | InChI=1S/C20H13F3N4/c21-20(22,23)15-5-6-19(26-12-15)27-16-7-9-25-18(11-16)14-4-3-13-2-1-8-24-17(13)10-14/h1-12H,(H,25,26,27) |
| InChIKey | CHMJHFQIBSGRCT-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.35 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |