C27H18F6N4O3S — CID 11592395
benzenesulfonic acid;6-quinolin-7-yl-2-(trifluoromethyl)-N-[4-(trifluoromethyl)phenyl]pyrimidin-4-amine (PubChem CID 11592395) has the molecular formula C27H18F6N4O3S and a molecular weight of 592.52 g/mol. Its IUPAC name is benzenesulfonic acid;6-quinolin-7-yl-2-(trifluoromethyl)-N-[4-(trifluoromethyl)phenyl]pyrimidin-4-amine.
| Compound Name | benzenesulfonic acid;6-quinolin-7-yl-2-(trifluoromethyl)-N-[4-(trifluoromethyl)phenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 11592395 |
| Molecular Formula | C27H18F6N4O3S |
| Molecular Weight | 592.52 g/mol |
| Exact Mass | 592.10 |
| IUPAC Name | benzenesulfonic acid;6-quinolin-7-yl-2-(trifluoromethyl)-N-[4-(trifluoromethyl)phenyl]pyrimidin-4-amine |
| SMILES | FC(F)(F)c1ccc(Nc2cc(-c3ccc4cccnc4c3)nc(C(F)(F)F)n2)cc1.O=S(=O)(O)c1ccccc1 |
| InChI | InChI=1S/C21H12F6N4.C6H6O3S/c22-20(23,24)14-5-7-15(8-6-14)29-18-11-17(30-19(31-18)21(25,26)27)13-4-3-12-2-1-9-28-16(12)10-13;7-10(8,9)6-4-2-1-3-5-6/h1-11H,(H,29,30,31);1-5H,(H,7,8,9) |
| InChIKey | NXPUMHZBSCZFOO-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 105.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.52 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|