C27H21F3N4O3S2 — CID 11577772
benzenesulfonic acid;2-methylsulfanyl-6-quinolin-7-yl-N-[4-(trifluoromethyl)phenyl]pyrimidin-4-amine (PubChem CID 11577772) has the molecular formula C27H21F3N4O3S2 and a molecular weight of 570.62 g/mol. Its IUPAC name is benzenesulfonic acid;2-methylsulfanyl-6-quinolin-7-yl-N-[4-(trifluoromethyl)phenyl]pyrimidin-4-amine.
| Compound Name | benzenesulfonic acid;2-methylsulfanyl-6-quinolin-7-yl-N-[4-(trifluoromethyl)phenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 11577772 |
| Molecular Formula | C27H21F3N4O3S2 |
| Molecular Weight | 570.62 g/mol |
| Exact Mass | 570.10 |
| IUPAC Name | benzenesulfonic acid;2-methylsulfanyl-6-quinolin-7-yl-N-[4-(trifluoromethyl)phenyl]pyrimidin-4-amine |
| SMILES | CSc1nc(Nc2ccc(C(F)(F)F)cc2)cc(-c2ccc3cccnc3c2)n1.O=S(=O)(O)c1ccccc1 |
| InChI | InChI=1S/C21H15F3N4S.C6H6O3S/c1-29-20-27-18(14-5-4-13-3-2-10-25-17(13)11-14)12-19(28-20)26-16-8-6-15(7-9-16)21(22,23)24;7-10(8,9)6-4-2-1-3-5-6/h2-12H,1H3,(H,26,27,28);1-5H,(H,7,8,9) |
| InChIKey | QNSSBGCEKODRPA-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 105.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.62 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|