C18H15N3O2S — CID 71352960
2-[(2-methylsulfanyl-6-phenylpyrimidin-4-yl)amino]benzoic acid (PubChem CID 71352960) has the molecular formula C18H15N3O2S and a molecular weight of 337.40 g/mol. Its IUPAC name is 2-[(2-methylsulfanyl-6-phenylpyrimidin-4-yl)amino]benzoic acid.
| Compound Name | 2-[(2-methylsulfanyl-6-phenylpyrimidin-4-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 71352960 |
| Molecular Formula | C18H15N3O2S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 2-[(2-methylsulfanyl-6-phenylpyrimidin-4-yl)amino]benzoic acid |
| SMILES | CSc1nc(Nc2ccccc2C(=O)O)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C18H15N3O2S/c1-24-18-20-15(12-7-3-2-4-8-12)11-16(21-18)19-14-10-6-5-9-13(14)17(22)23/h2-11H,1H3,(H,22,23)(H,19,20,21) |
| InChIKey | LEXVYBAYJJASKD-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |