C22H23N3O2S — CID 9150134
[4-[(2-methylsulfanyl-6-phenylpyrimidin-4-yl)amino]phenyl] 3-methylbutanoate (PubChem CID 9150134) has the molecular formula C22H23N3O2S and a molecular weight of 393.51 g/mol. Its IUPAC name is [4-[(2-methylsulfanyl-6-phenylpyrimidin-4-yl)amino]phenyl] 3-methylbutanoate.
| Compound Name | [4-[(2-methylsulfanyl-6-phenylpyrimidin-4-yl)amino]phenyl] 3-methylbutanoate |
|---|---|
| PubChem CID | 9150134 |
| Molecular Formula | C22H23N3O2S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | [4-[(2-methylsulfanyl-6-phenylpyrimidin-4-yl)amino]phenyl] 3-methylbutanoate |
| SMILES | CSc1nc(Nc2ccc(OC(=O)CC(C)C)cc2)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C22H23N3O2S/c1-15(2)13-21(26)27-18-11-9-17(10-12-18)23-20-14-19(24-22(25-20)28-3)16-7-5-4-6-8-16/h4-12,14-15H,13H2,1-3H3,(H,23,24,25) |
| InChIKey | WPPWXPVQSFIGFW-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|