C23H25N3O3S — CID 9149530
[4-[(2-benzylsulfanyl-6-methylpyrimidin-4-yl)amino]phenyl] 2-methylpropyl carbonate (PubChem CID 9149530) has the molecular formula C23H25N3O3S and a molecular weight of 423.54 g/mol. Its IUPAC name is [4-[(2-benzylsulfanyl-6-methylpyrimidin-4-yl)amino]phenyl] 2-methylpropyl carbonate.
| Compound Name | [4-[(2-benzylsulfanyl-6-methylpyrimidin-4-yl)amino]phenyl] 2-methylpropyl carbonate |
|---|---|
| PubChem CID | 9149530 |
| Molecular Formula | C23H25N3O3S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | [4-[(2-benzylsulfanyl-6-methylpyrimidin-4-yl)amino]phenyl] 2-methylpropyl carbonate |
| SMILES | Cc1cc(Nc2ccc(OC(=O)OCC(C)C)cc2)nc(SCc2ccccc2)n1 |
| InChI | InChI=1S/C23H25N3O3S/c1-16(2)14-28-23(27)29-20-11-9-19(10-12-20)25-21-13-17(3)24-22(26-21)30-15-18-7-5-4-6-8-18/h4-13,16H,14-15H2,1-3H3,(H,24,25,26) |
| InChIKey | XAHYNIVYYHJYSN-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|