C15H20N4S — CID 4118530
2-[2-(dimethylamino)ethylsulfanyl]-6-methyl-N-phenylpyrimidin-4-amine (PubChem CID 4118530) has the molecular formula C15H20N4S and a molecular weight of 288.42 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethylsulfanyl]-6-methyl-N-phenylpyrimidin-4-amine.
| Compound Name | 2-[2-(dimethylamino)ethylsulfanyl]-6-methyl-N-phenylpyrimidin-4-amine |
|---|---|
| PubChem CID | 4118530 |
| Molecular Formula | C15H20N4S |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 2-[2-(dimethylamino)ethylsulfanyl]-6-methyl-N-phenylpyrimidin-4-amine |
| SMILES | Cc1cc(Nc2ccccc2)nc(SCCN(C)C)n1 |
| InChI | InChI=1S/C15H20N4S/c1-12-11-14(17-13-7-5-4-6-8-13)18-15(16-12)20-10-9-19(2)3/h4-8,11H,9-10H2,1-3H3,(H,16,17,18) |
| InChIKey | VZMXBGPCOKDQDD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |