C16H15N5 — CID 117083923
6-methyl-4-N-phenyl-2-N-pyridin-4-ylpyrimidine-2,4-diamine (PubChem CID 117083923) has the molecular formula C16H15N5 and a molecular weight of 277.33 g/mol. Its IUPAC name is 6-methyl-4-N-phenyl-2-N-pyridin-4-ylpyrimidine-2,4-diamine.
| Compound Name | 6-methyl-4-N-phenyl-2-N-pyridin-4-ylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 117083923 |
| Molecular Formula | C16H15N5 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 6-methyl-4-N-phenyl-2-N-pyridin-4-ylpyrimidine-2,4-diamine |
| SMILES | Cc1cc(Nc2ccccc2)nc(Nc2ccncc2)n1 |
| InChI | InChI=1S/C16H15N5/c1-12-11-15(19-13-5-3-2-4-6-13)21-16(18-12)20-14-7-9-17-10-8-14/h2-11H,1H3,(H2,17,18,19,20,21) |
| InChIKey | KUTPSXNUKAGQGO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |