C19H22Cl3N3O2S — CID 25286534
N-[(1S)-1-(2-benzylsulfanyl-6-methylpyrimidin-4-yl)oxy-2,2,2-trichloroethyl]-2,2-dimethylpropanamide (PubChem CID 25286534) has the molecular formula C19H22Cl3N3O2S and a molecular weight of 462.83 g/mol. Its IUPAC name is N-[(1S)-1-(2-benzylsulfanyl-6-methylpyrimidin-4-yl)oxy-2,2,2-trichloroethyl]-2,2-dimethylpropanamide.
| Compound Name | N-[(1S)-1-(2-benzylsulfanyl-6-methylpyrimidin-4-yl)oxy-2,2,2-trichloroethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 25286534 |
| Molecular Formula | C19H22Cl3N3O2S |
| Molecular Weight | 462.83 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | N-[(1S)-1-(2-benzylsulfanyl-6-methylpyrimidin-4-yl)oxy-2,2,2-trichloroethyl]-2,2-dimethylpropanamide |
| SMILES | Cc1cc(O[C@H](NC(=O)C(C)(C)C)C(Cl)(Cl)Cl)nc(SCc2ccccc2)n1 |
| InChI | InChI=1S/C19H22Cl3N3O2S/c1-12-10-14(24-17(23-12)28-11-13-8-6-5-7-9-13)27-16(19(20,21)22)25-15(26)18(2,3)4/h5-10,16H,11H2,1-4H3,(H,25,26)/t16-/m0/s1 |
| InChIKey | KOTWXKUHMRFREO-INIZCTEOSA-N |
| XLogP | 5.31 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.83 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|