C9H11Cl3N4O2 — CID 911242
N-[(1R)-1-(2-amino-6-methylpyrimidin-4-yl)oxy-2,2,2-trichloroethyl]acetamide (PubChem CID 911242) has the molecular formula C9H11Cl3N4O2 and a molecular weight of 313.57 g/mol. Its IUPAC name is N-[(1R)-1-(2-amino-6-methylpyrimidin-4-yl)oxy-2,2,2-trichloroethyl]acetamide.
| Compound Name | N-[(1R)-1-(2-amino-6-methylpyrimidin-4-yl)oxy-2,2,2-trichloroethyl]acetamide |
|---|---|
| PubChem CID | 911242 |
| Molecular Formula | C9H11Cl3N4O2 |
| Molecular Weight | 313.57 g/mol |
| Exact Mass | 311.99 |
| IUPAC Name | N-[(1R)-1-(2-amino-6-methylpyrimidin-4-yl)oxy-2,2,2-trichloroethyl]acetamide |
| SMILES | CC(=O)N[C@H](Oc1cc(C)nc(N)n1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H11Cl3N4O2/c1-4-3-6(16-8(13)14-4)18-7(9(10,11)12)15-5(2)17/h3,7H,1-2H3,(H,15,17)(H2,13,14,16)/t7-/m1/s1 |
| InChIKey | GESIOVPOGMOALA-SSDOTTSWSA-N |
| XLogP | 1.58 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.57 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|