C11H10Cl3NO3 — CID 34317073
N-[(1R)-2,2,2-trichloro-1-(4-formylphenoxy)ethyl]acetamide (PubChem CID 34317073) has the molecular formula C11H10Cl3NO3 and a molecular weight of 310.56 g/mol. Its IUPAC name is N-[(1R)-2,2,2-trichloro-1-(4-formylphenoxy)ethyl]acetamide.
| Compound Name | N-[(1R)-2,2,2-trichloro-1-(4-formylphenoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 34317073 |
| Molecular Formula | C11H10Cl3NO3 |
| Molecular Weight | 310.56 g/mol |
| Exact Mass | 308.97 |
| IUPAC Name | N-[(1R)-2,2,2-trichloro-1-(4-formylphenoxy)ethyl]acetamide |
| SMILES | CC(=O)N[C@H](Oc1ccc(C=O)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H10Cl3NO3/c1-7(17)15-10(11(12,13)14)18-9-4-2-8(6-16)3-5-9/h2-6,10H,1H3,(H,15,17)/t10-/m1/s1 |
| InChIKey | UXYIKMWQEBMLDU-SNVBAGLBSA-N |
| XLogP | 2.71 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.56 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|