C17H15Cl3N2O5S2 — CID 26479549
3-[(5Z)-5-[[4-[(1R)-1-acetamido-2,2,2-trichloroethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid (PubChem CID 26479549) has the molecular formula C17H15Cl3N2O5S2 and a molecular weight of 497.81 g/mol. Its IUPAC name is 3-[(5Z)-5-[[4-[(1R)-1-acetamido-2,2,2-trichloroethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid.
| Compound Name | 3-[(5Z)-5-[[4-[(1R)-1-acetamido-2,2,2-trichloroethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 26479549 |
| Molecular Formula | C17H15Cl3N2O5S2 |
| Molecular Weight | 497.81 g/mol |
| Exact Mass | 495.95 |
| IUPAC Name | 3-[(5Z)-5-[[4-[(1R)-1-acetamido-2,2,2-trichloroethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
| SMILES | CC(=O)N[C@H](Oc1ccc(/C=C2\SC(=S)N(CCC(=O)O)C2=O)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C17H15Cl3N2O5S2/c1-9(23)21-15(17(18,19)20)27-11-4-2-10(3-5-11)8-12-14(26)22(16(28)29-12)7-6-13(24)25/h2-5,8,15H,6-7H2,1H3,(H,21,23)(H,24,25)/b12-8-/t15-/m1/s1 |
| InChIKey | IGIPRIFDZBDJTD-LDCOFTPGSA-N |
| XLogP | 3.57 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.81 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|