C17H17Cl3N2O3S2 — CID 44615071
N-[2,2,2-trichloro-1-[4-[(Z)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]ethyl]butanamide (PubChem CID 44615071) has the molecular formula C17H17Cl3N2O3S2 and a molecular weight of 467.83 g/mol. Its IUPAC name is N-[2,2,2-trichloro-1-[4-[(Z)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]ethyl]butanamide.
| Compound Name | N-[2,2,2-trichloro-1-[4-[(Z)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]ethyl]butanamide |
|---|---|
| PubChem CID | 44615071 |
| Molecular Formula | C17H17Cl3N2O3S2 |
| Molecular Weight | 467.83 g/mol |
| Exact Mass | 465.97 |
| IUPAC Name | N-[2,2,2-trichloro-1-[4-[(Z)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]ethyl]butanamide |
| SMILES | CCCC(=O)NC(Oc1ccc(/C=C2\SC(=S)N(C)C2=O)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C17H17Cl3N2O3S2/c1-3-4-13(23)21-15(17(18,19)20)25-11-7-5-10(6-8-11)9-12-14(24)22(2)16(26)27-12/h5-9,15H,3-4H2,1-2H3,(H,21,23)/b12-9- |
| InChIKey | LXZZSANKBLZNSX-XFXZXTDPSA-N |
| XLogP | 4.51 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.83 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|