C27H23Cl3N2O4S2 — CID 98194401
N-[(1S)-2,2,2-trichloro-1-[4-[(Z)-[3-(3-methoxypropyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]ethyl]naphthalene-1-carboxamide (PubChem CID 98194401) has the molecular formula C27H23Cl3N2O4S2 and a molecular weight of 609.98 g/mol. Its IUPAC name is N-[(1S)-2,2,2-trichloro-1-[4-[(Z)-[3-(3-methoxypropyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]ethyl]naphthalene-1-carboxamide.
| Compound Name | N-[(1S)-2,2,2-trichloro-1-[4-[(Z)-[3-(3-methoxypropyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]ethyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 98194401 |
| Molecular Formula | C27H23Cl3N2O4S2 |
| Molecular Weight | 609.98 g/mol |
| Exact Mass | 608.02 |
| IUPAC Name | N-[(1S)-2,2,2-trichloro-1-[4-[(Z)-[3-(3-methoxypropyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]ethyl]naphthalene-1-carboxamide |
| SMILES | COCCCN1C(=O)/C(=C/c2ccc(O[C@H](NC(=O)c3cccc4ccccc34)C(Cl)(Cl)Cl)cc2)SC1=S |
| InChI | InChI=1S/C27H23Cl3N2O4S2/c1-35-15-5-14-32-24(34)22(38-26(32)37)16-17-10-12-19(13-11-17)36-25(27(28,29)30)31-23(33)21-9-4-7-18-6-2-3-8-20(18)21/h2-4,6-13,16,25H,5,14-15H2,1H3,(H,31,33)/b22-16-/t25-/m0/s1 |
| InChIKey | ZCRFQYUVRUHCHP-YVVITCHPSA-N |
| XLogP | 6.58 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.98 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|