C27H25NO3S2 — CID 6030373
[4-[(E)-(3-hexyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] naphthalene-1-carboxylate (PubChem CID 6030373) has the molecular formula C27H25NO3S2 and a molecular weight of 475.64 g/mol. Its IUPAC name is [4-[(E)-(3-hexyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] naphthalene-1-carboxylate.
| Compound Name | [4-[(E)-(3-hexyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 6030373 |
| Molecular Formula | C27H25NO3S2 |
| Molecular Weight | 475.64 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | [4-[(E)-(3-hexyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] naphthalene-1-carboxylate |
| SMILES | CCCCCCN1C(=O)/C(=C\c2ccc(OC(=O)c3cccc4ccccc34)cc2)SC1=S |
| InChI | InChI=1S/C27H25NO3S2/c1-2-3-4-7-17-28-25(29)24(33-27(28)32)18-19-13-15-21(16-14-19)31-26(30)23-12-8-10-20-9-5-6-11-22(20)23/h5-6,8-16,18H,2-4,7,17H2,1H3/b24-18+ |
| InChIKey | FUQDYFUVDVAZMF-HKOYGPOVSA-N |
| XLogP | 6.84 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.64 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|