C22H31NO3S2 — CID 43833901
(5Z)-3-decyl-5-[[4-(2-hydroxyethoxy)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 43833901) has the molecular formula C22H31NO3S2 and a molecular weight of 421.63 g/mol. Its IUPAC name is (5Z)-3-decyl-5-[[4-(2-hydroxyethoxy)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-decyl-5-[[4-(2-hydroxyethoxy)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 43833901 |
| Molecular Formula | C22H31NO3S2 |
| Molecular Weight | 421.63 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | (5Z)-3-decyl-5-[[4-(2-hydroxyethoxy)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCCCCCCCCCN1C(=O)/C(=C/c2ccc(OCCO)cc2)SC1=S |
| InChI | InChI=1S/C22H31NO3S2/c1-2-3-4-5-6-7-8-9-14-23-21(25)20(28-22(23)27)17-18-10-12-19(13-11-18)26-16-15-24/h10-13,17,24H,2-9,14-16H2,1H3/b20-17- |
| InChIKey | VOIOAOLOJWJCNT-JZJYNLBNSA-N |
| XLogP | 5.40 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.63 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|