C20H23Cl3N2O4S2 — CID 94860706
N-[(1S)-2,2,2-trichloro-1-[4-[(Z)-[3-(3-methoxypropyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]ethyl]butanamide (PubChem CID 94860706) has the molecular formula C20H23Cl3N2O4S2 and a molecular weight of 525.91 g/mol. Its IUPAC name is N-[(1S)-2,2,2-trichloro-1-[4-[(Z)-[3-(3-methoxypropyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]ethyl]butanamide.
| Compound Name | N-[(1S)-2,2,2-trichloro-1-[4-[(Z)-[3-(3-methoxypropyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]ethyl]butanamide |
|---|---|
| PubChem CID | 94860706 |
| Molecular Formula | C20H23Cl3N2O4S2 |
| Molecular Weight | 525.91 g/mol |
| Exact Mass | 524.02 |
| IUPAC Name | N-[(1S)-2,2,2-trichloro-1-[4-[(Z)-[3-(3-methoxypropyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]ethyl]butanamide |
| SMILES | CCCC(=O)N[C@@H](Oc1ccc(/C=C2\SC(=S)N(CCCOC)C2=O)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C20H23Cl3N2O4S2/c1-3-5-16(26)24-18(20(21,22)23)29-14-8-6-13(7-9-14)12-15-17(27)25(19(30)31-15)10-4-11-28-2/h6-9,12,18H,3-5,10-11H2,1-2H3,(H,24,26)/b15-12-/t18-/m0/s1 |
| InChIKey | UFELZIAMOSAEKU-NZHZHZHDSA-N |
| XLogP | 4.92 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.91 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|