C26H18Cl4N2O3S2 — CID 71952347
N-[1-[4-[(3-benzyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-2,2,2-trichloroethyl]-4-chlorobenzamide (PubChem CID 71952347) has the molecular formula C26H18Cl4N2O3S2 and a molecular weight of 612.39 g/mol. Its IUPAC name is N-[1-[4-[(3-benzyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-2,2,2-trichloroethyl]-4-chlorobenzamide.
| Compound Name | N-[1-[4-[(3-benzyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-2,2,2-trichloroethyl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 71952347 |
| Molecular Formula | C26H18Cl4N2O3S2 |
| Molecular Weight | 612.39 g/mol |
| Exact Mass | 609.95 |
| IUPAC Name | N-[1-[4-[(3-benzyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-2,2,2-trichloroethyl]-4-chlorobenzamide |
| SMILES | O=C(NC(Oc1ccc(C=C2SC(=S)N(Cc3ccccc3)C2=O)cc1)C(Cl)(Cl)Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H18Cl4N2O3S2/c27-19-10-8-18(9-11-19)22(33)31-24(26(28,29)30)35-20-12-6-16(7-13-20)14-21-23(34)32(25(36)37-21)15-17-4-2-1-3-5-17/h1-14,24H,15H2,(H,31,33) |
| InChIKey | YMCRCJNYYKBQOG-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.39 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|