C25H19Cl3N2O5S2 — CID 98334432
N-[(1R)-2,2,2-trichloro-1-[4-[(Z)-[3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]ethyl]benzamide (PubChem CID 98334432) has the molecular formula C25H19Cl3N2O5S2 and a molecular weight of 597.93 g/mol. Its IUPAC name is N-[(1R)-2,2,2-trichloro-1-[4-[(Z)-[3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]ethyl]benzamide.
| Compound Name | N-[(1R)-2,2,2-trichloro-1-[4-[(Z)-[3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]ethyl]benzamide |
|---|---|
| PubChem CID | 98334432 |
| Molecular Formula | C25H19Cl3N2O5S2 |
| Molecular Weight | 597.93 g/mol |
| Exact Mass | 595.98 |
| IUPAC Name | N-[(1R)-2,2,2-trichloro-1-[4-[(Z)-[3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]ethyl]benzamide |
| SMILES | COc1cc(/C=C2\SC(=S)N(Cc3ccco3)C2=O)ccc1O[C@@H](NC(=O)c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C25H19Cl3N2O5S2/c1-33-19-12-15(13-20-22(32)30(24(36)37-20)14-17-8-5-11-34-17)9-10-18(19)35-23(25(26,27)28)29-21(31)16-6-3-2-4-7-16/h2-13,23H,14H2,1H3,(H,29,31)/b20-13-/t23-/m1/s1 |
| InChIKey | JLOMPGWRGFEKLC-JPFXZVHCSA-N |
| XLogP | 6.19 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.93 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|