C19H15Cl3N2O4S2 — CID 21178634
N-[2,2,2-trichloro-1-[4-[(Z)-[3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]ethyl]acetamide (PubChem CID 21178634) has the molecular formula C19H15Cl3N2O4S2 and a molecular weight of 505.83 g/mol. Its IUPAC name is N-[2,2,2-trichloro-1-[4-[(Z)-[3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]ethyl]acetamide.
| Compound Name | N-[2,2,2-trichloro-1-[4-[(Z)-[3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 21178634 |
| Molecular Formula | C19H15Cl3N2O4S2 |
| Molecular Weight | 505.83 g/mol |
| Exact Mass | 503.95 |
| IUPAC Name | N-[2,2,2-trichloro-1-[4-[(Z)-[3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]ethyl]acetamide |
| SMILES | CC(=O)NC(Oc1ccc(/C=C2\SC(=S)N(Cc3ccco3)C2=O)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C19H15Cl3N2O4S2/c1-11(25)23-17(19(20,21)22)28-13-6-4-12(5-7-13)9-15-16(26)24(18(29)30-15)10-14-3-2-8-27-14/h2-9,17H,10H2,1H3,(H,23,25)/b15-9- |
| InChIKey | HBIJDJVDVONRBN-DHDCSXOGSA-N |
| XLogP | 4.89 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.83 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|