C25H19Cl3N2O4S2 — CID 98334297
N-[(1R)-2,2,2-trichloro-1-[4-[(Z)-[4-oxo-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]ethyl]furan-2-carboxamide (PubChem CID 98334297) has the molecular formula C25H19Cl3N2O4S2 and a molecular weight of 581.93 g/mol. Its IUPAC name is N-[(1R)-2,2,2-trichloro-1-[4-[(Z)-[4-oxo-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]ethyl]furan-2-carboxamide.
| Compound Name | N-[(1R)-2,2,2-trichloro-1-[4-[(Z)-[4-oxo-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 98334297 |
| Molecular Formula | C25H19Cl3N2O4S2 |
| Molecular Weight | 581.93 g/mol |
| Exact Mass | 579.99 |
| IUPAC Name | N-[(1R)-2,2,2-trichloro-1-[4-[(Z)-[4-oxo-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]ethyl]furan-2-carboxamide |
| SMILES | O=C(N[C@H](Oc1ccc(/C=C2\SC(=S)N(CCc3ccccc3)C2=O)cc1)C(Cl)(Cl)Cl)c1ccco1 |
| InChI | InChI=1S/C25H19Cl3N2O4S2/c26-25(27,28)23(29-21(31)19-7-4-14-33-19)34-18-10-8-17(9-11-18)15-20-22(32)30(24(35)36-20)13-12-16-5-2-1-3-6-16/h1-11,14-15,23H,12-13H2,(H,29,31)/b20-15-/t23-/m1/s1 |
| InChIKey | NVGPPUUSSHCIMF-HVQRGMKJSA-N |
| XLogP | 6.23 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.93 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|