C20H21Cl3N2O5S2 — CID 71952420
3-[4-oxo-2-sulfanylidene-5-[[4-[2,2,2-trichloro-1-(3-methylbutanoylamino)ethoxy]phenyl]methylidene]-1,3-thiazolidin-3-yl]propanoic acid (PubChem CID 71952420) has the molecular formula C20H21Cl3N2O5S2 and a molecular weight of 539.89 g/mol. Its IUPAC name is 3-[4-oxo-2-sulfanylidene-5-[[4-[2,2,2-trichloro-1-(3-methylbutanoylamino)ethoxy]phenyl]methylidene]-1,3-thiazolidin-3-yl]propanoic acid.
| Compound Name | 3-[4-oxo-2-sulfanylidene-5-[[4-[2,2,2-trichloro-1-(3-methylbutanoylamino)ethoxy]phenyl]methylidene]-1,3-thiazolidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 71952420 |
| Molecular Formula | C20H21Cl3N2O5S2 |
| Molecular Weight | 539.89 g/mol |
| Exact Mass | 538.00 |
| IUPAC Name | 3-[4-oxo-2-sulfanylidene-5-[[4-[2,2,2-trichloro-1-(3-methylbutanoylamino)ethoxy]phenyl]methylidene]-1,3-thiazolidin-3-yl]propanoic acid |
| SMILES | CC(C)CC(=O)NC(Oc1ccc(C=C2SC(=S)N(CCC(=O)O)C2=O)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C20H21Cl3N2O5S2/c1-11(2)9-15(26)24-18(20(21,22)23)30-13-5-3-12(4-6-13)10-14-17(29)25(19(31)32-14)8-7-16(27)28/h3-6,10-11,18H,7-9H2,1-2H3,(H,24,26)(H,27,28) |
| InChIKey | XBLCGPZWXRVJOS-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.89 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|