C24H18Cl2N2O5S2 — CID 126275088
N-(2,4-dichlorophenyl)-2-[4-[(Z)-[3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]acetamide (PubChem CID 126275088) has the molecular formula C24H18Cl2N2O5S2 and a molecular weight of 549.46 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-2-[4-[(Z)-[3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]acetamide.
| Compound Name | N-(2,4-dichlorophenyl)-2-[4-[(Z)-[3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 126275088 |
| Molecular Formula | C24H18Cl2N2O5S2 |
| Molecular Weight | 549.46 g/mol |
| Exact Mass | 548.00 |
| IUPAC Name | N-(2,4-dichlorophenyl)-2-[4-[(Z)-[3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]acetamide |
| SMILES | COc1cc(/C=C2\SC(=S)N(Cc3ccco3)C2=O)ccc1OCC(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H18Cl2N2O5S2/c1-31-20-9-14(10-21-23(30)28(24(34)35-21)12-16-3-2-8-32-16)4-7-19(20)33-13-22(29)27-18-6-5-15(25)11-17(18)26/h2-11H,12-13H2,1H3,(H,27,29)/b21-10- |
| InChIKey | ZRQLJSUBJXJBCB-FBHDLOMBSA-N |
| XLogP | 6.01 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.46 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|