C22H19ClN4O5S3 — CID 18808119
N-[5-(2-chloroethyl)-1,3,4-thiadiazol-2-yl]-2-[4-[(Z)-[3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]acetamide (PubChem CID 18808119) has the molecular formula C22H19ClN4O5S3 and a molecular weight of 551.07 g/mol. Its IUPAC name is N-[5-(2-chloroethyl)-1,3,4-thiadiazol-2-yl]-2-[4-[(Z)-[3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]acetamide.
| Compound Name | N-[5-(2-chloroethyl)-1,3,4-thiadiazol-2-yl]-2-[4-[(Z)-[3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 18808119 |
| Molecular Formula | C22H19ClN4O5S3 |
| Molecular Weight | 551.07 g/mol |
| Exact Mass | 550.02 |
| IUPAC Name | N-[5-(2-chloroethyl)-1,3,4-thiadiazol-2-yl]-2-[4-[(Z)-[3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]acetamide |
| SMILES | COc1cc(/C=C2\SC(=S)N(Cc3ccco3)C2=O)ccc1OCC(=O)Nc1nnc(CCCl)s1 |
| InChI | InChI=1S/C22H19ClN4O5S3/c1-30-16-9-13(10-17-20(29)27(22(33)34-17)11-14-3-2-8-31-14)4-5-15(16)32-12-18(28)24-21-26-25-19(35-21)6-7-23/h2-5,8-10H,6-7,11-12H2,1H3,(H,24,26,28)/b17-10- |
| InChIKey | GUFNTKHKDHFHNG-YVLHZVERSA-N |
| XLogP | 4.34 |
| TPSA | 106.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.07 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|