C13H16O4 — CID 87176317
2-(4-formylphenoxy)-3,3-dimethylbutanoic acid (PubChem CID 87176317) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is 2-(4-formylphenoxy)-3,3-dimethylbutanoic acid.
| Compound Name | 2-(4-formylphenoxy)-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 87176317 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 2-(4-formylphenoxy)-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)C(Oc1ccc(C=O)cc1)C(=O)O |
| InChI | InChI=1S/C13H16O4/c1-13(2,3)11(12(15)16)17-10-6-4-9(8-14)5-7-10/h4-8,11H,1-3H3,(H,15,16) |
| InChIKey | NYCASPSYLPPOJW-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|