C13H11NO6 — CID 91047282
2-(2,5-dihydroxypyrrol-1-yl)-2-(4-formylphenoxy)acetic acid (PubChem CID 91047282) has the molecular formula C13H11NO6 and a molecular weight of 277.23 g/mol. Its IUPAC name is 2-(2,5-dihydroxypyrrol-1-yl)-2-(4-formylphenoxy)acetic acid.
| Compound Name | 2-(2,5-dihydroxypyrrol-1-yl)-2-(4-formylphenoxy)acetic acid |
|---|---|
| PubChem CID | 91047282 |
| Molecular Formula | C13H11NO6 |
| Molecular Weight | 277.23 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 2-(2,5-dihydroxypyrrol-1-yl)-2-(4-formylphenoxy)acetic acid |
| SMILES | O=Cc1ccc(OC(C(=O)O)n2c(O)ccc2O)cc1 |
| InChI | InChI=1S/C13H11NO6/c15-7-8-1-3-9(4-2-8)20-12(13(18)19)14-10(16)5-6-11(14)17/h1-7,12,16-17H,(H,18,19) |
| InChIKey | QARXIGJGBFGCKV-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 108.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.23 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|