About 4-hydroxybenzaldehyde;(1S)-1-phenylethanol;4-[(1R)-1-phenylethoxy]benzaldehyde
4-hydroxybenzaldehyde;(1S)-1-phenylethanol;4-[(1R)-1-phenylethoxy]benzaldehyde (PubChem CID 165110460) has the molecular formula C30H30O5
and a molecular weight of 470.57 g/mol. Its IUPAC name is 4-hydroxybenzaldehyde;(1S)-1-phenylethanol;4-[(1R)-1-phenylethoxy]benzaldehyde.
Molecular Properties
| Compound Name | 4-hydroxybenzaldehyde;(1S)-1-phenylethanol;4-[(1R)-1-phenylethoxy]benzaldehyde |
| PubChem CID | 165110460 |
| Molecular Formula | C30H30O5 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | 4-hydroxybenzaldehyde;(1S)-1-phenylethanol;4-[(1R)-1-phenylethoxy]benzaldehyde |
| SMILES | C[C@@H](Oc1ccc(C=O)cc1)c1ccccc1.C[C@H](O)c1ccccc1.O=Cc1ccc(O)cc1 |
| InChI | InChI=1S/C15H14O2.C8H10O.C7H6O2/c1-12(14-5-3-2-4-6-14)17-15-9-7-13(11-16)8-10-15;1-7(9)8-5-3-2-4-6-8;8-5-6-1-3-7(9)4-2-6/h2-12H,1H3;2-7,9H,1H3;1-5,9H/t12-;7-;/m10./s1 |
| InChIKey | ZVZSKSJOOUZSDC-MKTPXIFISA-N |
| XLogP | 6.58 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxybenzaldehyde;(1S)-1-phenylethanol;4-[(1R)-1-phenylethoxy]benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxybenzaldehyde;(1S)-1-phenylethanol;4-[(1R)-1-phenylethoxy]benzaldehyde?
The IUPAC name of 4-hydroxybenzaldehyde;(1S)-1-phenylethanol;4-[(1R)-1-phenylethoxy]benzaldehyde (CID 165110460) is 4-hydroxybenzaldehyde;(1S)-1-phenylethanol;4-[(1R)-1-phenylethoxy]benzaldehyde.
What is the SMILES notation for 4-hydroxybenzaldehyde;(1S)-1-phenylethanol;4-[(1R)-1-phenylethoxy]benzaldehyde?
The canonical SMILES for 4-hydroxybenzaldehyde;(1S)-1-phenylethanol;4-[(1R)-1-phenylethoxy]benzaldehyde is C[C@@H](Oc1ccc(C=O)cc1)c1ccccc1.C[C@H](O)c1ccccc1.O=Cc1ccc(O)cc1.
What is the InChIKey of 4-hydroxybenzaldehyde;(1S)-1-phenylethanol;4-[(1R)-1-phenylethoxy]benzaldehyde?
The InChIKey is ZVZSKSJOOUZSDC-MKTPXIFISA-N. The full InChI is InChI=1S/C15H14O2.C8H10O.C7H6O2/c1-12(14-5-3-2-4-6-14)17-15-9-7-13(11-16)8-10-15;1-7(9)8-5-3-2-4-6-8;8-5-6-1-3-7(9)4-2-6/h2-12H,1H3;2-7,9H,1H3;1-5,9H/t12-;7-;/m10./s1.
What are the key properties of 4-hydroxybenzaldehyde;(1S)-1-phenylethanol;4-[(1R)-1-phenylethoxy]benzaldehyde?
4-hydroxybenzaldehyde;(1S)-1-phenylethanol;4-[(1R)-1-phenylethoxy]benzaldehyde has a molecular weight of 470.57 g/mol, XLogP of 6.58, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxybenzaldehyde;(1S)-1-phenylethanol;4-[(1R)-1-phenylethoxy]benzaldehyde is sourced from PubChem (CID 165110460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).