C16H15Cl3N2O3 — CID 1381271
1-phenyl-3-[(1R)-2,2,2-trichloro-1-(4-methoxyphenoxy)ethyl]urea (PubChem CID 1381271) has the molecular formula C16H15Cl3N2O3 and a molecular weight of 389.67 g/mol. Its IUPAC name is 1-phenyl-3-[(1R)-2,2,2-trichloro-1-(4-methoxyphenoxy)ethyl]urea.
| Compound Name | 1-phenyl-3-[(1R)-2,2,2-trichloro-1-(4-methoxyphenoxy)ethyl]urea |
|---|---|
| PubChem CID | 1381271 |
| Molecular Formula | C16H15Cl3N2O3 |
| Molecular Weight | 389.67 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | 1-phenyl-3-[(1R)-2,2,2-trichloro-1-(4-methoxyphenoxy)ethyl]urea |
| SMILES | COc1ccc(O[C@@H](NC(=O)Nc2ccccc2)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C16H15Cl3N2O3/c1-23-12-7-9-13(10-8-12)24-14(16(17,18)19)21-15(22)20-11-5-3-2-4-6-11/h2-10,14H,1H3,(H2,20,21,22)/t14-/m1/s1 |
| InChIKey | DNLADCVCDRUDMH-CQSZACIVSA-N |
| XLogP | 4.59 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.67 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|