C26H24Cl6N4O4 — CID 99666874
1-(3-methylphenyl)-3-[(1R)-2,2,2-trichloro-1-[2-[(1R)-2,2,2-trichloro-1-[(3-methylphenyl)carbamoylamino]ethoxy]phenoxy]ethyl]urea (PubChem CID 99666874) has the molecular formula C26H24Cl6N4O4 and a molecular weight of 669.22 g/mol. Its IUPAC name is 1-(3-methylphenyl)-3-[(1R)-2,2,2-trichloro-1-[2-[(1R)-2,2,2-trichloro-1-[(3-methylphenyl)carbamoylamino]ethoxy]phenoxy]ethyl]urea.
| Compound Name | 1-(3-methylphenyl)-3-[(1R)-2,2,2-trichloro-1-[2-[(1R)-2,2,2-trichloro-1-[(3-methylphenyl)carbamoylamino]ethoxy]phenoxy]ethyl]urea |
|---|---|
| PubChem CID | 99666874 |
| Molecular Formula | C26H24Cl6N4O4 |
| Molecular Weight | 669.22 g/mol |
| Exact Mass | 665.99 |
| IUPAC Name | 1-(3-methylphenyl)-3-[(1R)-2,2,2-trichloro-1-[2-[(1R)-2,2,2-trichloro-1-[(3-methylphenyl)carbamoylamino]ethoxy]phenoxy]ethyl]urea |
| SMILES | Cc1cccc(NC(=O)N[C@H](Oc2ccccc2O[C@@H](NC(=O)Nc2cccc(C)c2)C(Cl)(Cl)Cl)C(Cl)(Cl)Cl)c1 |
| InChI | InChI=1S/C26H24Cl6N4O4/c1-15-7-5-9-17(13-15)33-23(37)35-21(25(27,28)29)39-19-11-3-4-12-20(19)40-22(26(30,31)32)36-24(38)34-18-10-6-8-16(2)14-18/h3-14,21-22H,1-2H3,(H2,33,35,37)(H2,34,36,38)/t21-,22-/m1/s1 |
| InChIKey | BGXWXJFAHWOWLR-FGZHOGPDSA-N |
| XLogP | 8.10 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.22 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|