C12H14Cl3N3O2S — CID 2301603
methyl N-[(1S)-2,2,2-trichloro-1-[(3-methylphenyl)carbamothioylamino]ethyl]carbamate (PubChem CID 2301603) has the molecular formula C12H14Cl3N3O2S and a molecular weight of 370.69 g/mol. Its IUPAC name is methyl N-[(1S)-2,2,2-trichloro-1-[(3-methylphenyl)carbamothioylamino]ethyl]carbamate.
| Compound Name | methyl N-[(1S)-2,2,2-trichloro-1-[(3-methylphenyl)carbamothioylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 2301603 |
| Molecular Formula | C12H14Cl3N3O2S |
| Molecular Weight | 370.69 g/mol |
| Exact Mass | 368.99 |
| IUPAC Name | methyl N-[(1S)-2,2,2-trichloro-1-[(3-methylphenyl)carbamothioylamino]ethyl]carbamate |
| SMILES | COC(=O)N[C@@H](NC(=S)Nc1cccc(C)c1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H14Cl3N3O2S/c1-7-4-3-5-8(6-7)16-10(21)17-9(12(13,14)15)18-11(19)20-2/h3-6,9H,1-2H3,(H,18,19)(H2,16,17,21)/t9-/m1/s1 |
| InChIKey | YWJJLDAJTTYUEH-SECBINFHSA-N |
| XLogP | 3.33 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.69 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|