C17H16Cl3N3O2S — CID 2829995
2-methyl-N-[2,2,2-trichloro-1-[(3-hydroxyphenyl)carbamothioylamino]ethyl]benzamide (PubChem CID 2829995) has the molecular formula C17H16Cl3N3O2S and a molecular weight of 432.76 g/mol. Its IUPAC name is 2-methyl-N-[2,2,2-trichloro-1-[(3-hydroxyphenyl)carbamothioylamino]ethyl]benzamide.
| Compound Name | 2-methyl-N-[2,2,2-trichloro-1-[(3-hydroxyphenyl)carbamothioylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 2829995 |
| Molecular Formula | C17H16Cl3N3O2S |
| Molecular Weight | 432.76 g/mol |
| Exact Mass | 431.00 |
| IUPAC Name | 2-methyl-N-[2,2,2-trichloro-1-[(3-hydroxyphenyl)carbamothioylamino]ethyl]benzamide |
| SMILES | Cc1ccccc1C(=O)NC(NC(=S)Nc1cccc(O)c1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C17H16Cl3N3O2S/c1-10-5-2-3-8-13(10)14(25)22-15(17(18,19)20)23-16(26)21-11-6-4-7-12(24)9-11/h2-9,15,24H,1H3,(H,22,25)(H2,21,23,26) |
| InChIKey | VJMWOTWSKYKKCG-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.76 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|