C16H13BrCl3NO3 — CID 1243183
N-[(1R)-1-(4-bromophenoxy)-2,2,2-trichloroethyl]-4-methoxybenzamide (PubChem CID 1243183) has the molecular formula C16H13BrCl3NO3 and a molecular weight of 453.55 g/mol. Its IUPAC name is N-[(1R)-1-(4-bromophenoxy)-2,2,2-trichloroethyl]-4-methoxybenzamide.
| Compound Name | N-[(1R)-1-(4-bromophenoxy)-2,2,2-trichloroethyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 1243183 |
| Molecular Formula | C16H13BrCl3NO3 |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 450.91 |
| IUPAC Name | N-[(1R)-1-(4-bromophenoxy)-2,2,2-trichloroethyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)N[C@H](Oc2ccc(Br)cc2)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C16H13BrCl3NO3/c1-23-12-6-2-10(3-7-12)14(22)21-15(16(18,19)20)24-13-8-4-11(17)5-9-13/h2-9,15H,1H3,(H,21,22)/t15-/m1/s1 |
| InChIKey | CVQFXHWUHKIJDU-OAHLLOKOSA-N |
| XLogP | 4.96 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|