C18H15BrClNO4 — CID 132604869
N-[1-(4-bromophenyl)-3-(4-methoxyphenyl)-1,3-dioxopropan-2-yl]-2-chloroacetamide (PubChem CID 132604869) has the molecular formula C18H15BrClNO4 and a molecular weight of 424.68 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)-3-(4-methoxyphenyl)-1,3-dioxopropan-2-yl]-2-chloroacetamide.
| Compound Name | N-[1-(4-bromophenyl)-3-(4-methoxyphenyl)-1,3-dioxopropan-2-yl]-2-chloroacetamide |
|---|---|
| PubChem CID | 132604869 |
| Molecular Formula | C18H15BrClNO4 |
| Molecular Weight | 424.68 g/mol |
| Exact Mass | 422.99 |
| IUPAC Name | N-[1-(4-bromophenyl)-3-(4-methoxyphenyl)-1,3-dioxopropan-2-yl]-2-chloroacetamide |
| SMILES | COc1ccc(C(=O)C(NC(=O)CCl)C(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C18H15BrClNO4/c1-25-14-8-4-12(5-9-14)18(24)16(21-15(22)10-20)17(23)11-2-6-13(19)7-3-11/h2-9,16H,10H2,1H3,(H,21,22) |
| InChIKey | GRWOKKGOUGMJHF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.68 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|