C14H18ClNO4 — CID 167813974
methyl (3S)-3-[(2-chloroacetyl)amino]-4-(4-methoxyphenyl)butanoate (PubChem CID 167813974) has the molecular formula C14H18ClNO4 and a molecular weight of 299.75 g/mol. Its IUPAC name is methyl (3S)-3-[(2-chloroacetyl)amino]-4-(4-methoxyphenyl)butanoate.
| Compound Name | methyl (3S)-3-[(2-chloroacetyl)amino]-4-(4-methoxyphenyl)butanoate |
|---|---|
| PubChem CID | 167813974 |
| Molecular Formula | C14H18ClNO4 |
| Molecular Weight | 299.75 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | methyl (3S)-3-[(2-chloroacetyl)amino]-4-(4-methoxyphenyl)butanoate |
| SMILES | COC(=O)C[C@H](Cc1ccc(OC)cc1)NC(=O)CCl |
| InChI | InChI=1S/C14H18ClNO4/c1-19-12-5-3-10(4-6-12)7-11(8-14(18)20-2)16-13(17)9-15/h3-6,11H,7-9H2,1-2H3,(H,16,17)/t11-/m0/s1 |
| InChIKey | JAKQZPNFEUVKPF-NSHDSACASA-N |
| XLogP | 1.52 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.75 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|