C12H12Cl3NO5 — CID 4168116
[2,2,2-trichloro-1-(methoxycarbonylamino)ethyl] 4-methoxybenzoate (PubChem CID 4168116) has the molecular formula C12H12Cl3NO5 and a molecular weight of 356.59 g/mol. Its IUPAC name is [2,2,2-trichloro-1-(methoxycarbonylamino)ethyl] 4-methoxybenzoate.
| Compound Name | [2,2,2-trichloro-1-(methoxycarbonylamino)ethyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 4168116 |
| Molecular Formula | C12H12Cl3NO5 |
| Molecular Weight | 356.59 g/mol |
| Exact Mass | 354.98 |
| IUPAC Name | [2,2,2-trichloro-1-(methoxycarbonylamino)ethyl] 4-methoxybenzoate |
| SMILES | COC(=O)NC(OC(=O)c1ccc(OC)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H12Cl3NO5/c1-19-8-5-3-7(4-6-8)9(17)21-10(12(13,14)15)16-11(18)20-2/h3-6,10H,1-2H3,(H,16,18) |
| InChIKey | NQVJHVTVVJUFDG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.59 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|