C13H15Cl4NO2 — CID 2831117
3-methyl-N-[2,2,2-trichloro-1-(4-chlorophenoxy)ethyl]butanamide (PubChem CID 2831117) has the molecular formula C13H15Cl4NO2 and a molecular weight of 359.08 g/mol. Its IUPAC name is 3-methyl-N-[2,2,2-trichloro-1-(4-chlorophenoxy)ethyl]butanamide.
| Compound Name | 3-methyl-N-[2,2,2-trichloro-1-(4-chlorophenoxy)ethyl]butanamide |
|---|---|
| PubChem CID | 2831117 |
| Molecular Formula | C13H15Cl4NO2 |
| Molecular Weight | 359.08 g/mol |
| Exact Mass | 356.99 |
| IUPAC Name | 3-methyl-N-[2,2,2-trichloro-1-(4-chlorophenoxy)ethyl]butanamide |
| SMILES | CC(C)CC(=O)NC(Oc1ccc(Cl)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H15Cl4NO2/c1-8(2)7-11(19)18-12(13(15,16)17)20-10-5-3-9(14)4-6-10/h3-6,8,12H,7H2,1-2H3,(H,18,19) |
| InChIKey | VOYPJSYWOFJREE-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.08 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|