C18H18Cl3N3O2 — CID 20845195
N-[2,2,2-trichloro-1-[4-[(Z)-C-phenylcarbonohydrazonoyl]phenoxy]ethyl]propanamide (PubChem CID 20845195) has the molecular formula C18H18Cl3N3O2 and a molecular weight of 414.72 g/mol. Its IUPAC name is N-[2,2,2-trichloro-1-[4-[(Z)-C-phenylcarbonohydrazonoyl]phenoxy]ethyl]propanamide.
| Compound Name | N-[2,2,2-trichloro-1-[4-[(Z)-C-phenylcarbonohydrazonoyl]phenoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 20845195 |
| Molecular Formula | C18H18Cl3N3O2 |
| Molecular Weight | 414.72 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | N-[2,2,2-trichloro-1-[4-[(Z)-C-phenylcarbonohydrazonoyl]phenoxy]ethyl]propanamide |
| SMILES | CCC(=O)NC(Oc1ccc(/C(=N\N)c2ccccc2)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C18H18Cl3N3O2/c1-2-15(25)23-17(18(19,20)21)26-14-10-8-13(9-11-14)16(24-22)12-6-4-3-5-7-12/h3-11,17H,2,22H2,1H3,(H,23,25)/b24-16- |
| InChIKey | JYWIYGONUCZHAB-JLPGSUDCSA-N |
| XLogP | 4.00 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.72 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|