C18H17Cl3N4O3 — CID 34259565
N-[(Z)-[4-[(1S)-2,2,2-trichloro-1-(propanoylamino)ethoxy]phenyl]methylideneamino]pyridine-4-carboxamide (PubChem CID 34259565) has the molecular formula C18H17Cl3N4O3 and a molecular weight of 443.72 g/mol. Its IUPAC name is N-[(Z)-[4-[(1S)-2,2,2-trichloro-1-(propanoylamino)ethoxy]phenyl]methylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[(Z)-[4-[(1S)-2,2,2-trichloro-1-(propanoylamino)ethoxy]phenyl]methylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 34259565 |
| Molecular Formula | C18H17Cl3N4O3 |
| Molecular Weight | 443.72 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | N-[(Z)-[4-[(1S)-2,2,2-trichloro-1-(propanoylamino)ethoxy]phenyl]methylideneamino]pyridine-4-carboxamide |
| SMILES | CCC(=O)N[C@@H](Oc1ccc(/C=N\NC(=O)c2ccncc2)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C18H17Cl3N4O3/c1-2-15(26)24-17(18(19,20)21)28-14-5-3-12(4-6-14)11-23-25-16(27)13-7-9-22-10-8-13/h3-11,17H,2H2,1H3,(H,24,26)(H,25,27)/b23-11-/t17-/m0/s1 |
| InChIKey | CGARDPIKBQQKCD-CMBCABCVSA-N |
| XLogP | 3.45 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.72 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|