C21H22N6O4 — CID 90677380
[1-[2-[4-[(E)-(pyridine-4-carbonylhydrazinylidene)methyl]phenoxy]ethyl]triazol-4-yl]methyl propanoate (PubChem CID 90677380) has the molecular formula C21H22N6O4 and a molecular weight of 422.45 g/mol. Its IUPAC name is [1-[2-[4-[(E)-(pyridine-4-carbonylhydrazinylidene)methyl]phenoxy]ethyl]triazol-4-yl]methyl propanoate.
| Compound Name | [1-[2-[4-[(E)-(pyridine-4-carbonylhydrazinylidene)methyl]phenoxy]ethyl]triazol-4-yl]methyl propanoate |
|---|---|
| PubChem CID | 90677380 |
| Molecular Formula | C21H22N6O4 |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | [1-[2-[4-[(E)-(pyridine-4-carbonylhydrazinylidene)methyl]phenoxy]ethyl]triazol-4-yl]methyl propanoate |
| SMILES | CCC(=O)OCc1cn(CCOc2ccc(/C=N/NC(=O)c3ccncc3)cc2)nn1 |
| InChI | InChI=1S/C21H22N6O4/c1-2-20(28)31-15-18-14-27(26-24-18)11-12-30-19-5-3-16(4-6-19)13-23-25-21(29)17-7-9-22-10-8-17/h3-10,13-14H,2,11-12,15H2,1H3,(H,25,29)/b23-13+ |
| InChIKey | HSVPOISJKKLMJQ-YDZHTSKRSA-N |
| XLogP | 1.97 |
| TPSA | 120.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|