C20H15Cl2N3O2 — CID 4154310
N-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]pyridine-4-carboxamide (PubChem CID 4154310) has the molecular formula C20H15Cl2N3O2 and a molecular weight of 400.27 g/mol. Its IUPAC name is N-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 4154310 |
| Molecular Formula | C20H15Cl2N3O2 |
| Molecular Weight | 400.27 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | N-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]pyridine-4-carboxamide |
| SMILES | O=C(NN=Cc1ccc(OCc2ccc(Cl)c(Cl)c2)cc1)c1ccncc1 |
| InChI | InChI=1S/C20H15Cl2N3O2/c21-18-6-3-15(11-19(18)22)13-27-17-4-1-14(2-5-17)12-24-25-20(26)16-7-9-23-10-8-16/h1-12H,13H2,(H,25,26) |
| InChIKey | NCVJKSRGXRWBHH-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.27 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|