C15H20Cl3NO2 — CID 7038293
N-[(1S)-2,2,2-trichloro-1-phenoxyethyl]heptanamide (PubChem CID 7038293) has the molecular formula C15H20Cl3NO2 and a molecular weight of 352.69 g/mol. Its IUPAC name is N-[(1S)-2,2,2-trichloro-1-phenoxyethyl]heptanamide.
| Compound Name | N-[(1S)-2,2,2-trichloro-1-phenoxyethyl]heptanamide |
|---|---|
| PubChem CID | 7038293 |
| Molecular Formula | C15H20Cl3NO2 |
| Molecular Weight | 352.69 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | N-[(1S)-2,2,2-trichloro-1-phenoxyethyl]heptanamide |
| SMILES | CCCCCCC(=O)N[C@@H](Oc1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C15H20Cl3NO2/c1-2-3-4-8-11-13(20)19-14(15(16,17)18)21-12-9-6-5-7-10-12/h5-7,9-10,14H,2-4,8,11H2,1H3,(H,19,20)/t14-/m0/s1 |
| InChIKey | WJTKADKOJPWDJN-AWEZNQCLSA-N |
| XLogP | 4.85 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.69 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|