C17H24Cl3NO3S — CID 5220374
N-[1-(benzenesulfonyl)-2,2,2-trichloroethyl]nonanamide (PubChem CID 5220374) has the molecular formula C17H24Cl3NO3S and a molecular weight of 428.81 g/mol. Its IUPAC name is N-[1-(benzenesulfonyl)-2,2,2-trichloroethyl]nonanamide.
| Compound Name | N-[1-(benzenesulfonyl)-2,2,2-trichloroethyl]nonanamide |
|---|---|
| PubChem CID | 5220374 |
| Molecular Formula | C17H24Cl3NO3S |
| Molecular Weight | 428.81 g/mol |
| Exact Mass | 427.05 |
| IUPAC Name | N-[1-(benzenesulfonyl)-2,2,2-trichloroethyl]nonanamide |
| SMILES | CCCCCCCCC(=O)NC(C(Cl)(Cl)Cl)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H24Cl3NO3S/c1-2-3-4-5-6-10-13-15(22)21-16(17(18,19)20)25(23,24)14-11-8-7-9-12-14/h7-9,11-12,16H,2-6,10,13H2,1H3,(H,21,22) |
| InChIKey | NYIMPZNBVYBROG-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.81 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|