C25H34N2O6S2 — CID 12012269
N-[1,5-bis(benzenesulfonyl)-5-(butanoylamino)pentyl]butanamide (PubChem CID 12012269) has the molecular formula C25H34N2O6S2 and a molecular weight of 522.69 g/mol. Its IUPAC name is N-[1,5-bis(benzenesulfonyl)-5-(butanoylamino)pentyl]butanamide.
| Compound Name | N-[1,5-bis(benzenesulfonyl)-5-(butanoylamino)pentyl]butanamide |
|---|---|
| PubChem CID | 12012269 |
| Molecular Formula | C25H34N2O6S2 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | N-[1,5-bis(benzenesulfonyl)-5-(butanoylamino)pentyl]butanamide |
| SMILES | CCCC(=O)NC(CCCC(NC(=O)CCC)S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H34N2O6S2/c1-3-12-22(28)26-24(34(30,31)20-14-7-5-8-15-20)18-11-19-25(27-23(29)13-4-2)35(32,33)21-16-9-6-10-17-21/h5-10,14-17,24-25H,3-4,11-13,18-19H2,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | KLJNFKZRALLHNV-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 126.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |