C22H28N2O6S — CID 15408466
benzyl N-[1-(benzenesulfonyl)-4-nitrooctyl]carbamate (PubChem CID 15408466) has the molecular formula C22H28N2O6S and a molecular weight of 448.54 g/mol. Its IUPAC name is benzyl N-[1-(benzenesulfonyl)-4-nitrooctyl]carbamate.
| Compound Name | benzyl N-[1-(benzenesulfonyl)-4-nitrooctyl]carbamate |
|---|---|
| PubChem CID | 15408466 |
| Molecular Formula | C22H28N2O6S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | benzyl N-[1-(benzenesulfonyl)-4-nitrooctyl]carbamate |
| SMILES | CCCCC(CCC(NC(=O)OCc1ccccc1)S(=O)(=O)c1ccccc1)[N+](=O)[O-] |
| InChI | InChI=1S/C22H28N2O6S/c1-2-3-12-19(24(26)27)15-16-21(31(28,29)20-13-8-5-9-14-20)23-22(25)30-17-18-10-6-4-7-11-18/h4-11,13-14,19,21H,2-3,12,15-17H2,1H3,(H,23,25) |
| InChIKey | BDGCUKLPJCUBIV-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|