C26H26N2O8S — CID 135064942
methyl (3S)-2-(4-nitrophenyl)sulfonyl-5-phenyl-3-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 135064942) has the molecular formula C26H26N2O8S and a molecular weight of 526.57 g/mol. Its IUPAC name is methyl (3S)-2-(4-nitrophenyl)sulfonyl-5-phenyl-3-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | methyl (3S)-2-(4-nitrophenyl)sulfonyl-5-phenyl-3-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 135064942 |
| Molecular Formula | C26H26N2O8S |
| Molecular Weight | 526.57 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | methyl (3S)-2-(4-nitrophenyl)sulfonyl-5-phenyl-3-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | COC(=O)C([C@H](CCc1ccccc1)NC(=O)OCc1ccccc1)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H26N2O8S/c1-35-25(29)24(37(33,34)22-15-13-21(14-16-22)28(31)32)23(17-12-19-8-4-2-5-9-19)27-26(30)36-18-20-10-6-3-7-11-20/h2-11,13-16,23-24H,12,17-18H2,1H3,(H,27,30)/t23-,24?/m0/s1 |
| InChIKey | WPPOPKZVTZNGPZ-UXMRNZNESA-N |
| XLogP | 3.84 |
| TPSA | 141.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.57 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|