C26H27NO6S — CID 135064297
methyl (3S)-2-(benzenesulfonyl)-5-phenyl-3-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 135064297) has the molecular formula C26H27NO6S and a molecular weight of 481.57 g/mol. Its IUPAC name is methyl (3S)-2-(benzenesulfonyl)-5-phenyl-3-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | methyl (3S)-2-(benzenesulfonyl)-5-phenyl-3-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 135064297 |
| Molecular Formula | C26H27NO6S |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | methyl (3S)-2-(benzenesulfonyl)-5-phenyl-3-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | COC(=O)C([C@H](CCc1ccccc1)NC(=O)OCc1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H27NO6S/c1-32-25(28)24(34(30,31)22-15-9-4-10-16-22)23(18-17-20-11-5-2-6-12-20)27-26(29)33-19-21-13-7-3-8-14-21/h2-16,23-24H,17-19H2,1H3,(H,27,29)/t23-,24?/m0/s1 |
| InChIKey | GFYNWLGSKRTNBV-UXMRNZNESA-N |
| XLogP | 3.93 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |